C21H48N2O3 — CID 158613342
2-[bis(2-hydroxyethyl)amino]ethanol;N,N-dipentylpentan-1-amine (PubChem CID 158613342) has the molecular formula C21H48N2O3 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;N,N-dipentylpentan-1-amine.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;N,N-dipentylpentan-1-amine |
|---|---|
| PubChem CID | 158613342 |
| Molecular Formula | C21H48N2O3 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.37 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;N,N-dipentylpentan-1-amine |
| SMILES | CCCCCN(CCCCC)CCCCC.OCCN(CCO)CCO |
| InChI | InChI=1S/C15H33N.C6H15NO3/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;8-4-1-7(2-5-9)3-6-10/h4-15H2,1-3H3;8-10H,1-6H2 |
| InChIKey | HXCIBDZCLATRBF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|