About 2-[heptyl(propyl)amino]ethanol;methanethiol
2-[heptyl(propyl)amino]ethanol;methanethiol (PubChem CID 177227133) has the molecular formula C13H31NOS
and a molecular weight of 249.46 g/mol. Its IUPAC name is 2-[heptyl(propyl)amino]ethanol;methanethiol.
Molecular Properties
| Compound Name | 2-[heptyl(propyl)amino]ethanol;methanethiol |
| PubChem CID | 177227133 |
| Molecular Formula | C13H31NOS |
| Molecular Weight | 249.46 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 2-[heptyl(propyl)amino]ethanol;methanethiol |
| SMILES | CCCCCCCN(CCC)CCO.CS |
| InChI | InChI=1S/C12H27NO.CH4S/c1-3-5-6-7-8-10-13(9-4-2)11-12-14;1-2/h14H,3-12H2,1-2H3;2H,1H3 |
| InChIKey | QWSYYNMYAVFUJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[heptyl(propyl)amino]ethanol;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[heptyl(propyl)amino]ethanol;methanethiol?
The IUPAC name of 2-[heptyl(propyl)amino]ethanol;methanethiol (CID 177227133) is 2-[heptyl(propyl)amino]ethanol;methanethiol.
What is the SMILES notation for 2-[heptyl(propyl)amino]ethanol;methanethiol?
The canonical SMILES for 2-[heptyl(propyl)amino]ethanol;methanethiol is CCCCCCCN(CCC)CCO.CS.
What is the InChIKey of 2-[heptyl(propyl)amino]ethanol;methanethiol?
The InChIKey is QWSYYNMYAVFUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO.CH4S/c1-3-5-6-7-8-10-13(9-4-2)11-12-14;1-2/h14H,3-12H2,1-2H3;2H,1H3.
What are the key properties of 2-[heptyl(propyl)amino]ethanol;methanethiol?
2-[heptyl(propyl)amino]ethanol;methanethiol has a molecular weight of 249.46 g/mol, XLogP of 3.21, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[heptyl(propyl)amino]ethanol;methanethiol is sourced from PubChem (CID 177227133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).