C22H48N2O2 — CID 150619896
N'-[2-(1,1-diethoxyethyl)decyl]hexane-1,6-diamine (PubChem CID 150619896) has the molecular formula C22H48N2O2 and a molecular weight of 372.64 g/mol. Its IUPAC name is N'-[2-(1,1-diethoxyethyl)decyl]hexane-1,6-diamine.
| Compound Name | N'-[2-(1,1-diethoxyethyl)decyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 150619896 |
| Molecular Formula | C22H48N2O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.37 |
| IUPAC Name | N'-[2-(1,1-diethoxyethyl)decyl]hexane-1,6-diamine |
| SMILES | CCCCCCCCC(CNCCCCCCN)C(C)(OCC)OCC |
| InChI | InChI=1S/C22H48N2O2/c1-5-8-9-10-11-14-17-21(22(4,25-6-2)26-7-3)20-24-19-16-13-12-15-18-23/h21,24H,5-20,23H2,1-4H3 |
| InChIKey | IVRFZVNMUGJAMC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|