C22H46N2O3 — CID 88520539
3-[3-(6-aminohexylamino)-2-hydroxypropyl]-2,2-dimethylundecanoic acid (PubChem CID 88520539) has the molecular formula C22H46N2O3 and a molecular weight of 386.62 g/mol. Its IUPAC name is 3-[3-(6-aminohexylamino)-2-hydroxypropyl]-2,2-dimethylundecanoic acid.
| Compound Name | 3-[3-(6-aminohexylamino)-2-hydroxypropyl]-2,2-dimethylundecanoic acid |
|---|---|
| PubChem CID | 88520539 |
| Molecular Formula | C22H46N2O3 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | 3-[3-(6-aminohexylamino)-2-hydroxypropyl]-2,2-dimethylundecanoic acid |
| SMILES | CCCCCCCCC(CC(O)CNCCCCCCN)C(C)(C)C(=O)O |
| InChI | InChI=1S/C22H46N2O3/c1-4-5-6-7-8-11-14-19(22(2,3)21(26)27)17-20(25)18-24-16-13-10-9-12-15-23/h19-20,24-25H,4-18,23H2,1-3H3,(H,26,27) |
| InChIKey | RHQQRURLAOQCEH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|