C20H43NO2 — CID 150210184
2-(1,1-diethoxyethyl)-N,N-diethyldecan-1-amine (PubChem CID 150210184) has the molecular formula C20H43NO2 and a molecular weight of 329.57 g/mol. Its IUPAC name is 2-(1,1-diethoxyethyl)-N,N-diethyldecan-1-amine.
| Compound Name | 2-(1,1-diethoxyethyl)-N,N-diethyldecan-1-amine |
|---|---|
| PubChem CID | 150210184 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 2-(1,1-diethoxyethyl)-N,N-diethyldecan-1-amine |
| SMILES | CCCCCCCCC(CN(CC)CC)C(C)(OCC)OCC |
| InChI | InChI=1S/C20H43NO2/c1-7-12-13-14-15-16-17-19(18-21(8-2)9-3)20(6,22-10-4)23-11-5/h19H,7-18H2,1-6H3 |
| InChIKey | FRHXWVXTVZDDSI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|