C22H45NO3 — CID 150051536
4-[4-(1,1-diethoxyethyl)dodecyl]morpholine (PubChem CID 150051536) has the molecular formula C22H45NO3 and a molecular weight of 371.61 g/mol. Its IUPAC name is 4-[4-(1,1-diethoxyethyl)dodecyl]morpholine.
| Compound Name | 4-[4-(1,1-diethoxyethyl)dodecyl]morpholine |
|---|---|
| PubChem CID | 150051536 |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | 4-[4-(1,1-diethoxyethyl)dodecyl]morpholine |
| SMILES | CCCCCCCCC(CCCN1CCOCC1)C(C)(OCC)OCC |
| InChI | InChI=1S/C22H45NO3/c1-5-8-9-10-11-12-14-21(22(4,25-6-2)26-7-3)15-13-16-23-17-19-24-20-18-23/h21H,5-20H2,1-4H3 |
| InChIKey | DLKRNQONXZWRDJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|