C26H41F5O2 — CID 151908395
1-[6-(1,1-diethoxyethyl)tetradecyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 151908395) has the molecular formula C26H41F5O2 and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-[6-(1,1-diethoxyethyl)tetradecyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[6-(1,1-diethoxyethyl)tetradecyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 151908395 |
| Molecular Formula | C26H41F5O2 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 1-[6-(1,1-diethoxyethyl)tetradecyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCCCCCCCC(CCCCCc1c(F)c(F)c(F)c(F)c1F)C(C)(OCC)OCC |
| InChI | InChI=1S/C26H41F5O2/c1-5-8-9-10-11-13-16-19(26(4,32-6-2)33-7-3)17-14-12-15-18-20-21(27)23(29)25(31)24(30)22(20)28/h19H,5-18H2,1-4H3 |
| InChIKey | SUFRDARGEHVSMO-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|