C28H45F5O3 — CID 150937440
1,1-dimethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol (PubChem CID 150937440) has the molecular formula C28H45F5O3 and a molecular weight of 524.66 g/mol. Its IUPAC name is 1,1-dimethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol.
| Compound Name | 1,1-dimethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol |
|---|---|
| PubChem CID | 150937440 |
| Molecular Formula | C28H45F5O3 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 1,1-dimethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol |
| SMILES | CCCCCCCCC(CCCCCCCCCCc1c(F)c(F)c(F)c(F)c1F)C(O)(OC)OC |
| InChI | InChI=1S/C28H45F5O3/c1-4-5-6-7-12-15-18-21(28(34,35-2)36-3)19-16-13-10-8-9-11-14-17-20-22-23(29)25(31)27(33)26(32)24(22)30/h21,34H,4-20H2,1-3H3 |
| InChIKey | LHICFILJDSOXGF-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|