C23H36F5NO3 — CID 150824595
1,1-diethoxy-2-[3-(2,3,4,5,6-pentafluoroanilino)propyl]decan-1-ol (PubChem CID 150824595) has the molecular formula C23H36F5NO3 and a molecular weight of 469.54 g/mol. Its IUPAC name is 1,1-diethoxy-2-[3-(2,3,4,5,6-pentafluoroanilino)propyl]decan-1-ol.
| Compound Name | 1,1-diethoxy-2-[3-(2,3,4,5,6-pentafluoroanilino)propyl]decan-1-ol |
|---|---|
| PubChem CID | 150824595 |
| Molecular Formula | C23H36F5NO3 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 1,1-diethoxy-2-[3-(2,3,4,5,6-pentafluoroanilino)propyl]decan-1-ol |
| SMILES | CCCCCCCCC(CCCNc1c(F)c(F)c(F)c(F)c1F)C(O)(OCC)OCC |
| InChI | InChI=1S/C23H36F5NO3/c1-4-7-8-9-10-11-13-16(23(30,31-5-2)32-6-3)14-12-15-29-22-20(27)18(25)17(24)19(26)21(22)28/h16,29-30H,4-15H2,1-3H3 |
| InChIKey | KKQNTHXDPDGBES-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|