C30H49F5N2O4 — CID 151001293
1-(2,3,4,5,6-pentafluorophenyl)-3-[5-(tripropoxymethyl)tridecyl]urea (PubChem CID 151001293) has the molecular formula C30H49F5N2O4 and a molecular weight of 596.72 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-3-[5-(tripropoxymethyl)tridecyl]urea.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-[5-(tripropoxymethyl)tridecyl]urea |
|---|---|
| PubChem CID | 151001293 |
| Molecular Formula | C30H49F5N2O4 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-[5-(tripropoxymethyl)tridecyl]urea |
| SMILES | CCCCCCCCC(CCCCNC(=O)Nc1c(F)c(F)c(F)c(F)c1F)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C30H49F5N2O4/c1-5-9-10-11-12-13-16-22(30(39-19-6-2,40-20-7-3)41-21-8-4)17-14-15-18-36-29(38)37-28-26(34)24(32)23(31)25(33)27(28)35/h22H,5-21H2,1-4H3,(H2,36,37,38) |
| InChIKey | LUDQQEWPQHQPAL-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|