C14H19F5N2O3Si — CID 90172008
1-[4-[dimethoxy(methyl)silyl]butyl]-3-(2,3,4,5,6-pentafluorophenyl)urea (PubChem CID 90172008) has the molecular formula C14H19F5N2O3Si and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-[4-[dimethoxy(methyl)silyl]butyl]-3-(2,3,4,5,6-pentafluorophenyl)urea.
| Compound Name | 1-[4-[dimethoxy(methyl)silyl]butyl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
|---|---|
| PubChem CID | 90172008 |
| Molecular Formula | C14H19F5N2O3Si |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[4-[dimethoxy(methyl)silyl]butyl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
| SMILES | CO[Si](C)(CCCCNC(=O)Nc1c(F)c(F)c(F)c(F)c1F)OC |
| InChI | InChI=1S/C14H19F5N2O3Si/c1-23-25(3,24-2)7-5-4-6-20-14(22)21-13-11(18)9(16)8(15)10(17)12(13)19/h4-7H2,1-3H3,(H2,20,21,22) |
| InChIKey | MZQUAULFTOOLBA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|