C12H14F5NO4Si — CID 90170706
N-[4-[dihydroxy(methoxy)silyl]butyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 90170706) has the molecular formula C12H14F5NO4Si and a molecular weight of 359.32 g/mol. Its IUPAC name is N-[4-[dihydroxy(methoxy)silyl]butyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[4-[dihydroxy(methoxy)silyl]butyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 90170706 |
| Molecular Formula | C12H14F5NO4Si |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[4-[dihydroxy(methoxy)silyl]butyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CO[Si](O)(O)CCCCNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H14F5NO4Si/c1-22-23(20,21)5-3-2-4-18-12(19)6-7(13)9(15)11(17)10(16)8(6)14/h20-21H,2-5H2,1H3,(H,18,19) |
| InChIKey | KCORGUWPWJSJLP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|