C20H32F4N2O4Si — CID 59172569
2,3,5,6-tetrafluoro-4-(octan-4-ylamino)-N-(2-trimethoxysilylethyl)benzamide (PubChem CID 59172569) has the molecular formula C20H32F4N2O4Si and a molecular weight of 468.56 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(octan-4-ylamino)-N-(2-trimethoxysilylethyl)benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-(octan-4-ylamino)-N-(2-trimethoxysilylethyl)benzamide |
|---|---|
| PubChem CID | 59172569 |
| Molecular Formula | C20H32F4N2O4Si |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(octan-4-ylamino)-N-(2-trimethoxysilylethyl)benzamide |
| SMILES | CCCCC(CCC)Nc1c(F)c(F)c(C(=O)NCC[Si](OC)(OC)OC)c(F)c1F |
| InChI | InChI=1S/C20H32F4N2O4Si/c1-6-8-10-13(9-7-2)26-19-17(23)15(21)14(16(22)18(19)24)20(27)25-11-12-31(28-3,29-4)30-5/h13,26H,6-12H2,1-5H3,(H,25,27) |
| InChIKey | QMTHEACCOWLQDX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|