C15H20F5NO4Si — CID 90175282
N-[3-[diethoxy(methoxy)silyl]propyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 90175282) has the molecular formula C15H20F5NO4Si and a molecular weight of 401.40 g/mol. Its IUPAC name is N-[3-[diethoxy(methoxy)silyl]propyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-[diethoxy(methoxy)silyl]propyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 90175282 |
| Molecular Formula | C15H20F5NO4Si |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[3-[diethoxy(methoxy)silyl]propyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCO[Si](CCCNC(=O)c1c(F)c(F)c(F)c(F)c1F)(OC)OCC |
| InChI | InChI=1S/C15H20F5NO4Si/c1-4-24-26(23-3,25-5-2)8-6-7-21-15(22)9-10(16)12(18)14(20)13(19)11(9)17/h4-8H2,1-3H3,(H,21,22) |
| InChIKey | PYXMYLXRCKRPOL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|