C14H18F5NO5Si — CID 90171901
(2,3,4,5,6-pentafluorophenyl) N-[3-[ethoxy(dimethoxy)silyl]propyl]carbamate (PubChem CID 90171901) has the molecular formula C14H18F5NO5Si and a molecular weight of 403.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[3-[ethoxy(dimethoxy)silyl]propyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[3-[ethoxy(dimethoxy)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 90171901 |
| Molecular Formula | C14H18F5NO5Si |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[3-[ethoxy(dimethoxy)silyl]propyl]carbamate |
| SMILES | CCO[Si](CCCNC(=O)Oc1c(F)c(F)c(F)c(F)c1F)(OC)OC |
| InChI | InChI=1S/C14H18F5NO5Si/c1-4-24-26(22-2,23-3)7-5-6-20-14(21)25-13-11(18)9(16)8(15)10(17)12(13)19/h4-7H2,1-3H3,(H,20,21) |
| InChIKey | UDZOGWRNTZXVHF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|