C13H17F5N2O4Si — CID 90174028
1-(2,3,4,5,6-pentafluorophenyl)-3-(3-trimethoxysilylpropyl)urea (PubChem CID 90174028) has the molecular formula C13H17F5N2O4Si and a molecular weight of 388.37 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-3-(3-trimethoxysilylpropyl)urea.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(3-trimethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 90174028 |
| Molecular Formula | C13H17F5N2O4Si |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(3-trimethoxysilylpropyl)urea |
| SMILES | CO[Si](CCCNC(=O)Nc1c(F)c(F)c(F)c(F)c1F)(OC)OC |
| InChI | InChI=1S/C13H17F5N2O4Si/c1-22-25(23-2,24-3)6-4-5-19-13(21)20-12-10(17)8(15)7(14)9(16)11(12)18/h4-6H2,1-3H3,(H2,19,20,21) |
| InChIKey | HQDVABZUUISHCR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|