C24H37F5N2O2 — CID 150831276
1-(2,3,4,5,6-pentafluorophenyl)-3-(5-propoxytetradecyl)urea (PubChem CID 150831276) has the molecular formula C24H37F5N2O2 and a molecular weight of 480.56 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-3-(5-propoxytetradecyl)urea.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(5-propoxytetradecyl)urea |
|---|---|
| PubChem CID | 150831276 |
| Molecular Formula | C24H37F5N2O2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(5-propoxytetradecyl)urea |
| SMILES | CCCCCCCCCC(CCCCNC(=O)Nc1c(F)c(F)c(F)c(F)c1F)OCCC |
| InChI | InChI=1S/C24H37F5N2O2/c1-3-5-6-7-8-9-10-13-17(33-16-4-2)14-11-12-15-30-24(32)31-23-21(28)19(26)18(25)20(27)22(23)29/h17H,3-16H2,1-2H3,(H2,30,31,32) |
| InChIKey | KLZZIUXFLCRIPI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|