C24H36F5NO5 — CID 152605963
(2,3,4,5,6-pentafluorophenyl) N-[5-(trimethoxymethyl)tridecyl]carbamate (PubChem CID 152605963) has the molecular formula C24H36F5NO5 and a molecular weight of 513.54 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[5-(trimethoxymethyl)tridecyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[5-(trimethoxymethyl)tridecyl]carbamate |
|---|---|
| PubChem CID | 152605963 |
| Molecular Formula | C24H36F5NO5 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[5-(trimethoxymethyl)tridecyl]carbamate |
| SMILES | CCCCCCCCC(CCCCNC(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(OC)(OC)OC |
| InChI | InChI=1S/C24H36F5NO5/c1-5-6-7-8-9-10-13-16(24(32-2,33-3)34-4)14-11-12-15-30-23(31)35-22-20(28)18(26)17(25)19(27)21(22)29/h16H,5-15H2,1-4H3,(H,30,31) |
| InChIKey | YYMWACQKHKCKHZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|