C14H18F5NO3Si — CID 90172412
(2,3,4,5,6-pentafluorophenyl) N-[4-[methoxy(dimethyl)silyl]butyl]carbamate (PubChem CID 90172412) has the molecular formula C14H18F5NO3Si and a molecular weight of 371.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[4-[methoxy(dimethyl)silyl]butyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[4-[methoxy(dimethyl)silyl]butyl]carbamate |
|---|---|
| PubChem CID | 90172412 |
| Molecular Formula | C14H18F5NO3Si |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[4-[methoxy(dimethyl)silyl]butyl]carbamate |
| SMILES | CO[Si](C)(C)CCCCNC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H18F5NO3Si/c1-22-24(2,3)7-5-4-6-20-14(21)23-13-11(18)9(16)8(15)10(17)12(13)19/h4-7H2,1-3H3,(H,20,21) |
| InChIKey | ZQLIWQPPJBNNMX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|