C13H16F5NO5Si — CID 90171931
(2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(methoxy)silyl]methyl]carbamate (PubChem CID 90171931) has the molecular formula C13H16F5NO5Si and a molecular weight of 389.35 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(methoxy)silyl]methyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(methoxy)silyl]methyl]carbamate |
|---|---|
| PubChem CID | 90171931 |
| Molecular Formula | C13H16F5NO5Si |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(methoxy)silyl]methyl]carbamate |
| SMILES | CCO[Si](CNC(=O)Oc1c(F)c(F)c(F)c(F)c1F)(OC)OCC |
| InChI | InChI=1S/C13H16F5NO5Si/c1-4-22-25(21-3,23-5-2)6-19-13(20)24-12-10(17)8(15)7(14)9(16)11(12)18/h4-6H2,1-3H3,(H,19,20) |
| InChIKey | VENKEVJSSGVADT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|