C11H11F5O3 — CID 171836152
ethane;ethyl (2,3,4,5,6-pentafluorophenyl) carbonate (PubChem CID 171836152) has the molecular formula C11H11F5O3 and a molecular weight of 286.20 g/mol. Its IUPAC name is ethane;ethyl (2,3,4,5,6-pentafluorophenyl) carbonate.
| Compound Name | ethane;ethyl (2,3,4,5,6-pentafluorophenyl) carbonate |
|---|---|
| PubChem CID | 171836152 |
| Molecular Formula | C11H11F5O3 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | ethane;ethyl (2,3,4,5,6-pentafluorophenyl) carbonate |
| SMILES | CC.CCOC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5O3.C2H6/c1-2-16-9(15)17-8-6(13)4(11)3(10)5(12)7(8)14;1-2/h2H2,1H3;1-2H3 |
| InChIKey | AATDXYWFOAJFAX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|