C18H20O8 — CID 14302873
(4-ethoxycarbonyloxy-2,3-dimethoxynaphthalen-1-yl) ethyl carbonate (PubChem CID 14302873) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is (4-ethoxycarbonyloxy-2,3-dimethoxynaphthalen-1-yl) ethyl carbonate.
| Compound Name | (4-ethoxycarbonyloxy-2,3-dimethoxynaphthalen-1-yl) ethyl carbonate |
|---|---|
| PubChem CID | 14302873 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (4-ethoxycarbonyloxy-2,3-dimethoxynaphthalen-1-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1c(OC)c(OC)c(OC(=O)OCC)c2ccccc12 |
| InChI | InChI=1S/C18H20O8/c1-5-23-17(19)25-13-11-9-7-8-10-12(11)14(26-18(20)24-6-2)16(22-4)15(13)21-3/h7-10H,5-6H2,1-4H3 |
| InChIKey | JHXWFXWFZCPUGW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|