C19H22O5 — CID 75164211
ethyl 2-methyl-3-(1,3,4-trimethoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 75164211) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl 2-methyl-3-(1,3,4-trimethoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | ethyl 2-methyl-3-(1,3,4-trimethoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75164211 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | ethyl 2-methyl-3-(1,3,4-trimethoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1c(OC)c(OC)c2ccccc2c1OC |
| InChI | InChI=1S/C19H22O5/c1-6-24-19(20)12(2)11-15-16(21-3)13-9-7-8-10-14(13)17(22-4)18(15)23-5/h7-11H,6H2,1-5H3 |
| InChIKey | AELBILWWTLSYAJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|