C16H21ClO6 — CID 46179966
ethyl (E)-3-(2-chloro-3,4,5,6-tetramethoxyphenyl)-2-methylprop-2-enoate (PubChem CID 46179966) has the molecular formula C16H21ClO6 and a molecular weight of 344.79 g/mol. Its IUPAC name is ethyl (E)-3-(2-chloro-3,4,5,6-tetramethoxyphenyl)-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-(2-chloro-3,4,5,6-tetramethoxyphenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 46179966 |
| Molecular Formula | C16H21ClO6 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethyl (E)-3-(2-chloro-3,4,5,6-tetramethoxyphenyl)-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1c(Cl)c(OC)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H21ClO6/c1-7-23-16(18)9(2)8-10-11(17)13(20-4)15(22-6)14(21-5)12(10)19-3/h8H,7H2,1-6H3/b9-8+ |
| InChIKey | AXVCONSKPUVXET-CMDGGOBGSA-N |
| XLogP | 3.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|