C12H18N2O2 — CID 104503671
ethyl 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 104503671) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is ethyl 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | ethyl 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 104503671 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | ethyl 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H18N2O2/c1-6-16-12(15)8(2)7-11-9(3)13-14(5)10(11)4/h7H,6H2,1-5H3 |
| InChIKey | QEKHRRYJZMZNHO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|