2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid

C9H11FN2O2 — CID 79726145

IUPAC2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid
SMILESCc1nn(C)c(C)c1C=C(F)C(=O)O
InChIInChI=1S/C9H11FN2O2/c1-5-7(4-8(10)9(13)14)6(2)12(3)11-5/h4H,1-3H3,(H,13,14)
InChIKeyMRURRHZIYKNYND-UHFFFAOYSA-N
MW198.20 g/mol
LogP1.43
Rot. Bonds2

About 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid

2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid (PubChem CID 79726145) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid.

Molecular Properties

Compound Name2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid
PubChem CID79726145
Molecular FormulaC9H11FN2O2
Molecular Weight198.20 g/mol
Exact Mass198.08
IUPAC Name2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid
SMILESCc1nn(C)c(C)c1C=C(F)C(=O)O
InChIInChI=1S/C9H11FN2O2/c1-5-7(4-8(10)9(13)14)6(2)12(3)11-5/h4H,1-3H3,(H,13,14)
InChIKeyMRURRHZIYKNYND-UHFFFAOYSA-N
XLogP1.43
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.20
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid?
The IUPAC name of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid (CID 79726145) is 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid.
What is the SMILES notation for 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid?
The canonical SMILES for 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid is Cc1nn(C)c(C)c1C=C(F)C(=O)O.
What is the InChIKey of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid?
The InChIKey is MRURRHZIYKNYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O2/c1-5-7(4-8(10)9(13)14)6(2)12(3)11-5/h4H,1-3H3,(H,13,14).
What are the key properties of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid?
2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid has a molecular weight of 198.20 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid is sourced from PubChem (CID 79726145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).