About (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid
(2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid (PubChem CID 78972942) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid |
| PubChem CID | 78972942 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid |
| SMILES | Cc1nn(C)c(C)c1C=CC(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C12H17N3O3/c1-7-10(9(3)15(4)14-7)5-6-11(16)13-8(2)12(17)18/h5-6,8H,1-4H3,(H,13,16)(H,17,18)/t8-/m1/s1 |
| InChIKey | JWFDPVVBWRDTRD-MRVPVSSYSA-N |
| XLogP | 0.64 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid?
The IUPAC name of (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid (CID 78972942) is (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid.
What is the SMILES notation for (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid?
The canonical SMILES for (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid is Cc1nn(C)c(C)c1C=CC(=O)N[C@H](C)C(=O)O.
What is the InChIKey of (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid?
The InChIKey is JWFDPVVBWRDTRD-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-7-10(9(3)15(4)14-7)5-6-11(16)13-8(2)12(17)18/h5-6,8H,1-4H3,(H,13,16)(H,17,18)/t8-/m1/s1.
What are the key properties of (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid?
(2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid has a molecular weight of 251.29 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoylamino]propanoic acid is sourced from PubChem (CID 78972942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).