C12H19N3O3 — CID 77064785
N-(1,3-dihydroxypropan-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 77064785) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 77064785 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(C)c(C)c1C=CC(=O)NC(CO)CO |
| InChI | InChI=1S/C12H19N3O3/c1-8-11(9(2)15(3)14-8)4-5-12(18)13-10(6-16)7-17/h4-5,10,16-17H,6-7H2,1-3H3,(H,13,18) |
| InChIKey | ROGACGFYLUHFKQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|