C15H23N3O3 — CID 43356410
3-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]pentanoic acid (PubChem CID 43356410) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]pentanoic acid.
| Compound Name | 3-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43356410 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)/C=C/c1c(C)nn(C)c1C)C(=O)O |
| InChI | InChI=1S/C15H23N3O3/c1-6-9(2)14(15(20)21)16-13(19)8-7-12-10(3)17-18(5)11(12)4/h7-9,14H,6H2,1-5H3,(H,16,19)(H,20,21)/b8-7+ |
| InChIKey | ORXJTTVERMEDDK-BQYQJAHWSA-N |
| XLogP | 1.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|