C13H18N4O4 — CID 107820947
(2R)-4-amino-4-oxo-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]butanoic acid (PubChem CID 107820947) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2R)-4-amino-4-oxo-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]butanoic acid.
| Compound Name | (2R)-4-amino-4-oxo-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107820947 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2R)-4-amino-4-oxo-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]butanoic acid |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H18N4O4/c1-7-9(8(2)17(3)16-7)4-5-12(19)15-10(13(20)21)6-11(14)18/h4-5,10H,6H2,1-3H3,(H2,14,18)(H,15,19)(H,20,21)/b5-4+/t10-/m1/s1 |
| InChIKey | QDKLWSRUNUIPEY-ORAHPGNNSA-N |
| XLogP | -0.51 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|