C10H13NO2S — CID 104503690
ethyl 2-methyl-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate (PubChem CID 104503690) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is ethyl 2-methyl-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate.
| Compound Name | ethyl 2-methyl-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 104503690 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | ethyl 2-methyl-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1scnc1C |
| InChI | InChI=1S/C10H13NO2S/c1-4-13-10(12)7(2)5-9-8(3)11-6-14-9/h5-6H,4H2,1-3H3 |
| InChIKey | WZQLGHPGXPVSIJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|