C12H18N2O3S — CID 113420093
ethyl 3-[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]-2-methylprop-2-enoate (PubChem CID 113420093) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is ethyl 3-[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 113420093 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 3-[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1sc(N(C)C)nc1OC |
| InChI | InChI=1S/C12H18N2O3S/c1-6-17-11(15)8(2)7-9-10(16-5)13-12(18-9)14(3)4/h7H,6H2,1-5H3 |
| InChIKey | KFGNCVQCKOUSEC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|