C14H18O5 — CID 67318536
ethyl 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-methylprop-2-enoate (PubChem CID 67318536) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-methylprop-2-enoate.
| Compound Name | ethyl 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67318536 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C14H18O5/c1-5-19-14(16)9(2)6-10-7-11(17-3)13(15)12(8-10)18-4/h6-8,15H,5H2,1-4H3 |
| InChIKey | LXXBLZMJVANTOQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|