C17H22O6 — CID 25012932
propyl (2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxopentanoate (PubChem CID 25012932) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is propyl (2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxopentanoate.
| Compound Name | propyl (2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxopentanoate |
|---|---|
| PubChem CID | 25012932 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | propyl (2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxopentanoate |
| SMILES | CCCOC(=O)/C(=C/c1cc(OC)c(O)c(OC)c1)C(=O)CC |
| InChI | InChI=1S/C17H22O6/c1-5-7-23-17(20)12(13(18)6-2)8-11-9-14(21-3)16(19)15(10-11)22-4/h8-10,19H,5-7H2,1-4H3/b12-8+ |
| InChIKey | VRWSPNOPNKERTD-XYOKQWHBSA-N |
| XLogP | 2.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|