C18H24O6 — CID 69098741
pentyl 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxobutanoate (PubChem CID 69098741) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is pentyl 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxobutanoate.
| Compound Name | pentyl 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 69098741 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | pentyl 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-oxobutanoate |
| SMILES | CCCCCOC(=O)C(=Cc1cc(OC)c(O)c(OC)c1)C(C)=O |
| InChI | InChI=1S/C18H24O6/c1-5-6-7-8-24-18(21)14(12(2)19)9-13-10-15(22-3)17(20)16(11-13)23-4/h9-11,20H,5-8H2,1-4H3 |
| InChIKey | FCXHAQJQRJZIRI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|