C17H22O5 — CID 134518332
(3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]heptane-2,4-dione (PubChem CID 134518332) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]heptane-2,4-dione.
| Compound Name | (3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]heptane-2,4-dione |
|---|---|
| PubChem CID | 134518332 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]heptane-2,4-dione |
| SMILES | CCCC(=O)/C(=C/c1cc(OC)c(OC)c(OC)c1)C(C)=O |
| InChI | InChI=1S/C17H22O5/c1-6-7-14(19)13(11(2)18)8-12-9-15(20-3)17(22-5)16(10-12)21-4/h8-10H,6-7H2,1-5H3/b13-8+ |
| InChIKey | MZVDMSFQBBERHC-MDWZMJQESA-N |
| XLogP | 3.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|