C14H17NO7 — CID 54447200
[2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enyl] acetate (PubChem CID 54447200) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is [2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enyl] acetate.
| Compound Name | [2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enyl] acetate |
|---|---|
| PubChem CID | 54447200 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | [2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enyl] acetate |
| SMILES | COc1cc(C=C(COC(C)=O)[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C14H17NO7/c1-9(16)22-8-11(15(17)18)5-10-6-12(19-2)14(21-4)13(7-10)20-3/h5-7H,8H2,1-4H3 |
| InChIKey | WSIWKXWWNWUFQE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|