C13H15NO7 — CID 71335673
methyl 2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 71335673) has the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. Its IUPAC name is methyl 2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | methyl 2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71335673 |
| Molecular Formula | C13H15NO7 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl 2-nitro-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COC(=O)C(=Cc1cc(OC)c(OC)c(OC)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO7/c1-18-10-6-8(7-11(19-2)12(10)20-3)5-9(14(16)17)13(15)21-4/h5-7H,1-4H3 |
| InChIKey | AXPDKTSOSRCSLX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|