C14H17NO6 — CID 2740034
2-acetamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 2740034) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-acetamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-acetamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2740034 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-acetamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=C(NC(C)=O)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C14H17NO6/c1-8(16)15-10(14(17)18)5-9-6-11(19-2)13(21-4)12(7-9)20-3/h5-7H,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | GYSVZYOQLKZIHA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|