C18H24O7 — CID 177384775
diethyl (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]butanedioate (PubChem CID 177384775) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is diethyl (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]butanedioate.
| Compound Name | diethyl (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]butanedioate |
|---|---|
| PubChem CID | 177384775 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | diethyl (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]butanedioate |
| SMILES | CCOC(=O)C/C(=C/c1cc(OC)c(OC)c(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C18H24O7/c1-6-24-16(19)11-13(18(20)25-7-2)8-12-9-14(21-3)17(23-5)15(10-12)22-4/h8-10H,6-7,11H2,1-5H3/b13-8- |
| InChIKey | VAYPGYLHQZSMPC-JYRVWZFOSA-N |
| XLogP | 2.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|