C35H38O12 — CID 11467908
1-O-ethyl 4-O-(2-methoxy-2-oxo-1-phenylethyl) (2E,3E)-2,3-bis[(3,4,5-trimethoxyphenyl)methylidene]butanedioate (PubChem CID 11467908) has the molecular formula C35H38O12 and a molecular weight of 650.68 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(2-methoxy-2-oxo-1-phenylethyl) (2E,3E)-2,3-bis[(3,4,5-trimethoxyphenyl)methylidene]butanedioate.
| Compound Name | 1-O-ethyl 4-O-(2-methoxy-2-oxo-1-phenylethyl) (2E,3E)-2,3-bis[(3,4,5-trimethoxyphenyl)methylidene]butanedioate |
|---|---|
| PubChem CID | 11467908 |
| Molecular Formula | C35H38O12 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | 1-O-ethyl 4-O-(2-methoxy-2-oxo-1-phenylethyl) (2E,3E)-2,3-bis[(3,4,5-trimethoxyphenyl)methylidene]butanedioate |
| SMILES | CCOC(=O)C(=C/c1cc(OC)c(OC)c(OC)c1)/C(=C\c1cc(OC)c(OC)c(OC)c1)C(=O)OC(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C35H38O12/c1-9-46-33(36)24(15-21-17-26(39-2)31(43-6)27(18-21)40-3)25(16-22-19-28(41-4)32(44-7)29(20-22)42-5)34(37)47-30(35(38)45-8)23-13-11-10-12-14-23/h10-20,30H,9H2,1-8H3/b24-15+,25-16+ |
| InChIKey | AUGAIJMQCWDHSW-FEZYOMQXSA-N |
| XLogP | 5.23 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|