C42H40O8 — CID 101480934
ethyl (2Z)-2-[[3-methoxy-4,5-bis(phenylmethoxy)phenyl]methylidene]-4-(3-methoxy-4-phenylmethoxyphenyl)-3-oxobutanoate (PubChem CID 101480934) has the molecular formula C42H40O8 and a molecular weight of 672.77 g/mol. Its IUPAC name is ethyl (2Z)-2-[[3-methoxy-4,5-bis(phenylmethoxy)phenyl]methylidene]-4-(3-methoxy-4-phenylmethoxyphenyl)-3-oxobutanoate.
| Compound Name | ethyl (2Z)-2-[[3-methoxy-4,5-bis(phenylmethoxy)phenyl]methylidene]-4-(3-methoxy-4-phenylmethoxyphenyl)-3-oxobutanoate |
|---|---|
| PubChem CID | 101480934 |
| Molecular Formula | C42H40O8 |
| Molecular Weight | 672.77 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | ethyl (2Z)-2-[[3-methoxy-4,5-bis(phenylmethoxy)phenyl]methylidene]-4-(3-methoxy-4-phenylmethoxyphenyl)-3-oxobutanoate |
| SMILES | CCOC(=O)/C(=C\c1cc(OC)c(OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)Cc1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C42H40O8/c1-4-47-42(44)35(36(43)23-33-20-21-37(38(24-33)45-2)48-27-30-14-8-5-9-15-30)22-34-25-39(46-3)41(50-29-32-18-12-7-13-19-32)40(26-34)49-28-31-16-10-6-11-17-31/h5-22,24-26H,4,23,27-29H2,1-3H3/b35-22- |
| InChIKey | HYMQNKDSEPKVLT-QHDYCIAZSA-N |
| XLogP | 8.20 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|