C27H31NO4 — CID 3541865
ethyl 3-[benzyl-[(3-methoxy-4-phenylmethoxyphenyl)methyl]amino]propanoate (PubChem CID 3541865) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 3-[benzyl-[(3-methoxy-4-phenylmethoxyphenyl)methyl]amino]propanoate.
| Compound Name | ethyl 3-[benzyl-[(3-methoxy-4-phenylmethoxyphenyl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 3541865 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | ethyl 3-[benzyl-[(3-methoxy-4-phenylmethoxyphenyl)methyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)Cc1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H31NO4/c1-3-31-27(29)16-17-28(19-22-10-6-4-7-11-22)20-24-14-15-25(26(18-24)30-2)32-21-23-12-8-5-9-13-23/h4-15,18H,3,16-17,19-21H2,1-2H3 |
| InChIKey | COJDTHWKDZCTME-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |