C25H26FNO4 — CID 142696090
2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]acetic acid (PubChem CID 142696090) has the molecular formula C25H26FNO4 and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 142696090 |
| Molecular Formula | C25H26FNO4 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]acetic acid |
| SMILES | COc1cc(CCN(CC(=O)O)Cc2ccccc2)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C25H26FNO4/c1-30-24-15-19(10-11-23(24)31-18-21-8-5-9-22(26)14-21)12-13-27(17-25(28)29)16-20-6-3-2-4-7-20/h2-11,14-15H,12-13,16-18H2,1H3,(H,28,29) |
| InChIKey | LNKHULYGNAZYJE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |