C31H36ClFN4O3 — CID 66591165
2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride (PubChem CID 66591165) has the molecular formula C31H36ClFN4O3 and a molecular weight of 567.11 g/mol. Its IUPAC name is 2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride.
| Compound Name | 2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 66591165 |
| Molecular Formula | C31H36ClFN4O3 |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 2-[benzyl-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]amino]-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride |
| SMILES | COc1cc(CCN(CC(=O)NCCCn2ccnc2)Cc2ccccc2)ccc1OCc1cccc(F)c1.Cl |
| InChI | InChI=1S/C31H35FN4O3.ClH/c1-38-30-20-25(11-12-29(30)39-23-27-9-5-10-28(32)19-27)13-17-36(21-26-7-3-2-4-8-26)22-31(37)34-14-6-16-35-18-15-33-24-35;/h2-5,7-12,15,18-20,24H,6,13-14,16-17,21-23H2,1H3,(H,34,37);1H |
| InChIKey | SUGMDGHEJNRIGW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|