C25H27NO4 — CID 8933781
N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methyl-2-phenylmethoxybenzamide (PubChem CID 8933781) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methyl-2-phenylmethoxybenzamide.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methyl-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 8933781 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methyl-2-phenylmethoxybenzamide |
| SMILES | CCOc1ccc(CN(C)C(=O)c2ccccc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H27NO4/c1-4-29-23-15-14-20(16-24(23)28-3)17-26(2)25(27)21-12-8-9-13-22(21)30-18-19-10-6-5-7-11-19/h5-16H,4,17-18H2,1-3H3 |
| InChIKey | QXCPGVFTILSGCX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |