C20H25NO5 — CID 18113269
2-ethoxy-N-methyl-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide (PubChem CID 18113269) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-ethoxy-N-methyl-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 2-ethoxy-N-methyl-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18113269 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-ethoxy-N-methyl-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)N(C)Cc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C20H25NO5/c1-6-26-16-10-8-7-9-15(16)20(22)21(2)13-14-11-12-17(23-3)19(25-5)18(14)24-4/h7-12H,6,13H2,1-5H3 |
| InChIKey | HZAWNFMEOXBPCU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |