C20H19BrO6 — CID 43023156
(2-methoxy-2-oxo-1-phenylethyl) 4-(5-bromo-2-methoxyphenyl)-4-oxobutanoate (PubChem CID 43023156) has the molecular formula C20H19BrO6 and a molecular weight of 435.27 g/mol. Its IUPAC name is (2-methoxy-2-oxo-1-phenylethyl) 4-(5-bromo-2-methoxyphenyl)-4-oxobutanoate.
| Compound Name | (2-methoxy-2-oxo-1-phenylethyl) 4-(5-bromo-2-methoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 43023156 |
| Molecular Formula | C20H19BrO6 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | (2-methoxy-2-oxo-1-phenylethyl) 4-(5-bromo-2-methoxyphenyl)-4-oxobutanoate |
| SMILES | COC(=O)C(OC(=O)CCC(=O)c1cc(Br)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C20H19BrO6/c1-25-17-10-8-14(21)12-15(17)16(22)9-11-18(23)27-19(20(24)26-2)13-6-4-3-5-7-13/h3-8,10,12,19H,9,11H2,1-2H3 |
| InChIKey | DLXGSSJUAPEOFE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |