C16H13BrO4 — CID 50850566
1-(5-bromo-2-methoxyphenyl)-3-(2-hydroxyphenyl)propane-1,3-dione (PubChem CID 50850566) has the molecular formula C16H13BrO4 and a molecular weight of 349.18 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-(2-hydroxyphenyl)propane-1,3-dione.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 50850566 |
| Molecular Formula | C16H13BrO4 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
| SMILES | COc1ccc(Br)cc1C(=O)CC(=O)c1ccccc1O |
| InChI | InChI=1S/C16H13BrO4/c1-21-16-7-6-10(17)8-12(16)15(20)9-14(19)11-4-2-3-5-13(11)18/h2-8,18H,9H2,1H3 |
| InChIKey | IWOBNJCBKRSRAO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|