C17H26BrClN2O3 — CID 119668428
N-(1-aminohexan-2-yl)-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride (PubChem CID 119668428) has the molecular formula C17H26BrClN2O3 and a molecular weight of 421.76 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119668428 |
| Molecular Formula | C17H26BrClN2O3 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)CCC(=O)c1cc(Br)ccc1OC.Cl |
| InChI | InChI=1S/C17H25BrN2O3.ClH/c1-3-4-5-13(11-19)20-17(22)9-7-15(21)14-10-12(18)6-8-16(14)23-2;/h6,8,10,13H,3-5,7,9,11,19H2,1-2H3,(H,20,22);1H |
| InChIKey | FTANSDGPNKUZIJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |